Cloned (Comment) | Organism |
---|---|
recombinant expression in Pichia pastoris strain GS115, the enzyme is secreted to the culture medium | Botrytis cinerea |
recombinant overexpression of His-tagged isozyme PME31 in Escherichia coli strain JM101 | Arabidopsis thaliana |
Inhibitors | Comment | Organism | Structure |
---|---|---|---|
(E)-1-(2-nitroethenyl)-4-(2-propenyloxy)-benzene | - |
Arabidopsis thaliana | |
(E)-1-(2-nitroethenyl)-4-(2-propenyloxy)-benzene | - |
Citrus sinensis | |
1-(3,4-dihydroxyphenyl)-2-([1-(1-naphthyl)-1H-tetrazol-5-yl]thio)ethanone | - |
Arabidopsis thaliana | |
1-(3,4-dihydroxyphenyl)-2-([1-(1-naphthyl)-1H-tetrazol-5-yl]thio)ethanone | - |
Citrus sinensis | |
1-(3,6-dichloro-9H-carbazoyl-9-yl)-3-morpholinopropan-2-ol | - |
Arabidopsis thaliana | |
1-(3,6-dichloro-9H-carbazoyl-9-yl)-3-morpholinopropan-2-ol | - |
Citrus sinensis | |
10-(hydroxymethylene)-9(10H)-phenanthrenone | - |
Arabidopsis thaliana | |
10-(hydroxymethylene)-9(10H)-phenanthrenone | - |
Citrus sinensis | |
2-(2-[4-(trifluoromethyl)phenyl]hydrazylidene)propanedinitrile | - |
Arabidopsis thaliana | |
2-(2-[4-(trifluoromethyl)phenyl]hydrazylidene)propanedinitrile | - |
Citrus sinensis | |
2-(3,4-dihydro-1(2H)-naphthalenylidene)hydrazinecarbothioamide | - |
Arabidopsis thaliana | |
2-(3,4-dihydro-1(2H)-naphthalenylidene)hydrazinecarbothioamide | - |
Citrus sinensis | |
2-(3-chloro-2-fluorophenyl)-2,3-dihydroisothiazol-3-one | - |
Arabidopsis thaliana | |
2-(3-chloro-2-fluorophenyl)-2,3-dihydroisothiazol-3-one | - |
Citrus sinensis | |
2-chloro-3-(2-methylphenoxy)-1,4-dihydro-naphthalene-1,4-dione | - |
Arabidopsis thaliana | |
2-chloro-3-(2-methylphenoxy)-1,4-dihydro-naphthalene-1,4-dione | - |
Citrus sinensis | |
2-methoxyacridin-9-amine | - |
Arabidopsis thaliana | |
2-methoxyacridin-9-amine | - |
Citrus sinensis | |
2-[(4-chlorophenyl)sulfonyl]-2,4-dihydro-4-(2-propen-1-yl)-5-propyl-3H-pyrazol-3-one | - |
Arabidopsis thaliana | |
2-[(4-chlorophenyl)sulfonyl]-2,4-dihydro-4-(2-propen-1-yl)-5-propyl-3H-pyrazol-3-one | - |
Citrus sinensis | |
3H-pyrazol-3-one | - |
Arabidopsis thaliana | |
3H-pyrazol-3-one | - |
Citrus sinensis | |
4-(3-hydroxy-3-methylbut-1-ynyl)benzaldehyde-2-phenylhydrazone | - |
Arabidopsis thaliana | |
4-(3-hydroxy-3-methylbut-1-ynyl)benzaldehyde-2-phenylhydrazone | - |
Citrus sinensis | |
4-[1-(fur-2-oyl)pyrazol-5-yl]-5-methyl-1-phenylpyrazole | - |
Arabidopsis thaliana | |
4-[1-(fur-2-oyl)pyrazol-5-yl]-5-methyl-1-phenylpyrazole | - |
Citrus sinensis | |
copper sulfate | - |
Arabidopsis thaliana | |
copper sulfate | only slight inhibition | Citrus sinensis | |
hydrazine | - |
Arabidopsis thaliana | |
hydrazine | - |
Citrus sinensis | |
additional information | analysis of inhibition of the enzyme by polyphenols such as catechins and tannic acid, overview | Arabidopsis thaliana | |
additional information | analysis of inhibition of the enzyme by polyphenols such as catechins and tannic acid, or polyphenon 60 mixture, overview. The fungal PME is not sensitive to inhibition, overview | Botrytis cinerea | |
additional information | analysis of inhibition of the enzyme by polyphenols such as catechins and tannic acid, overview | Citrus sinensis | |
N'1-[2-(tert-butyl)-5-(trifluoromethyl)-pyrazolo[1,5-alpha]-pyrimidin-7-yl]-4-chlorobenzenohydrazide | - |
Arabidopsis thaliana | |
N'1-[2-(tert-butyl)-5-(trifluoromethyl)-pyrazolo[1,5-alpha]-pyrimidin-7-yl]-4-chlorobenzenohydrazide | - |
Citrus sinensis | |
N'6-[3,5-di-(trifluoromethyl)phenyl]-5-oxo-2,3-dihydro-5H-pyrimido-[2,1-b][1,3]thiazole-6-carbohydrazide | - |
Arabidopsis thaliana | |
N'6-[3,5-di-(trifluoromethyl)phenyl]-5-oxo-2,3-dihydro-5H-pyrimido-[2,1-b][1,3]thiazole-6-carbohydrazide | - |
Citrus sinensis | |
N-(1,4-dibenzoyl-5-phenyl-4,5-dihydro-1H-1,2,4-triazol-3-yl)-benzamide | - |
Arabidopsis thaliana | |
N-(1,4-dibenzoyl-5-phenyl-4,5-dihydro-1H-1,2,4-triazol-3-yl)-benzamide | - |
Citrus sinensis | |
N-(3,5-dichlorophenyl)-N'-[5-(2-furyl)-1H-pyrazol-3-yl]urea | - |
Arabidopsis thaliana | |
N-(3,5-dichlorophenyl)-N'-[5-(2-furyl)-1H-pyrazol-3-yl]urea | - |
Citrus sinensis | |
N-(4-chloro-2-nitrophenyl)-N'-phenylurea | - |
Arabidopsis thaliana | |
N-(4-chloro-2-nitrophenyl)-N'-phenylurea | - |
Citrus sinensis | |
N-(4-methyl-2-thienyl)-N'-[4-(trifluoromethyl)phenyl]-urea | - |
Arabidopsis thaliana | |
N-(4-methyl-2-thienyl)-N'-[4-(trifluoromethyl)phenyl]-urea | - |
Citrus sinensis | |
N-[(2-chlorobenzoyl)oxy]-2,1,3-benzoxadiazole-5-carboximidamide | - |
Arabidopsis thaliana | |
N-[(2-chlorobenzoyl)oxy]-2,1,3-benzoxadiazole-5-carboximidamide | - |
Citrus sinensis | |
N1-[3-(trifluoromethyl)phenyl]-3-(2-thienylthio)-propanamide | - |
Arabidopsis thaliana | |
N1-[3-(trifluoromethyl)phenyl]-3-(2-thienylthio)-propanamide | - |
Citrus sinensis | |
N4-(2-furylmethyl)-2-(2,3-dihydro-1,4-benzodioxin-2-yl)-1,3-thiazole-4-carboxamide | - |
Arabidopsis thaliana | |
N4-(2-furylmethyl)-2-(2,3-dihydro-1,4-benzodioxin-2-yl)-1,3-thiazole-4-carboxamide | - |
Citrus sinensis | |
phenylmercuric acetate | - |
Arabidopsis thaliana | |
phenylmercuric acetate | - |
Citrus sinensis | |
polyphenon 60 | PP60, commercial inhibitor mixture that contains 60% catechin (which consists of 34% (-)-epigallocatechin-3-gallate, 16.7% (-)-epigallocatechin, 8.7% (-)-epicatechin-3-gallate, 7.3% (-)-epicatechin, 2.8% (-)-gallocatechin gallate, and 0.5% (-)-catechin gallate), tannic acid, or (-)-epigallocatechin-3-gallate | Arabidopsis thaliana | |
polyphenon 60 | PP60, commercial inhibitor mixture that contains 60% catechin (which consists of 34% (-)-epigallocatechin-3-gallate, 16.7% (-)-epigallocatechin, 8.7% (-)-epicatechin-3-gallate, 7.3% (-)-epicatechin, 2.8% (-)-gallocatechin gallate, and 0.5% (-)-catechin gallate), tannic acid, or (-)-epigallocatechin-3-gallate | Citrus sinensis | |
Silver nitrate | complete inhibition | Arabidopsis thaliana | |
Silver nitrate | complete inhibition | Citrus sinensis | |
[5-(4-chlorophenyl)-3-thienyl]-(piperidino)-methanone | - |
Arabidopsis thaliana | |
[5-(4-chlorophenyl)-3-thienyl]-(piperidino)-methanone | - |
Citrus sinensis |
Natural Substrates | Organism | Comment (Nat. Sub.) | Natural Products | Comment (Nat. Pro.) | Rev. | Reac. |
---|---|---|---|---|---|---|
pectin + n H2O | Citrus sinensis | - |
n methanol + pectate | - |
? | |
pectin + n H2O | Arabidopsis thaliana | - |
n methanol + pectate | - |
? | |
pectin + n H2O | Botrytis cinerea | - |
n methanol + pectate | - |
? | |
pectin + n H2O | Botrytis cinerea B05.10 | - |
n methanol + pectate | - |
? |
Organism | UniProt | Comment | Textmining |
---|---|---|---|
Arabidopsis thaliana | Q9LVQ0 | - |
- |
Botrytis cinerea | A0A384J5R9 | i.e. Botryotinia fuckeliana | - |
Botrytis cinerea B05.10 | A0A384J5R9 | i.e. Botryotinia fuckeliana | - |
Citrus sinensis | O04886 | PME1 | - |
Purification (Comment) | Organism |
---|---|
recombinant enzyme from Pichia pastoris strain GS115 culture medium by dialysis and anion exchange chromatography | Botrytis cinerea |
recombinant His-tagged isozyme PME31 from Escherichia coli strain JM101 by nickel affinity chromatography | Arabidopsis thaliana |
Source Tissue | Comment | Organism | Textmining |
---|---|---|---|
commercial preparation | - |
Citrus sinensis | - |
fruit peel | - |
Citrus sinensis | - |
Substrates | Comment Substrates | Organism | Products | Comment (Products) | Rev. | Reac. |
---|---|---|---|---|---|---|
homogalacturonan + H2O | different homogalacturonan substrates, best at pH 4.0-6.0 for enzyme BcPME | Citrus sinensis | ? | - |
? | |
homogalacturonan + H2O | different homogalacturonan substrates, best at pH 4.0-6.0 for enzyme BcPME | Arabidopsis thaliana | ? | - |
? | |
homogalacturonan + H2O | different homogalacturonan substrates, best at pH 4.0-6.0 for enzyme BcPME | Botrytis cinerea | ? | - |
? | |
homogalacturonan + H2O | different homogalacturonan substrates, best at pH 4.0-6.0 for enzyme BcPME | Botrytis cinerea B05.10 | ? | - |
? | |
additional information | substrate specificity, overview. Homogalacturonan substrates are HG96B20, HG96B39 HG96B56, HG96B69, HG96B82, HG96P14, HG96P36, HG96P56, HG96P64, and HG96P75. Spectrometric quantification | Citrus sinensis | ? | - |
? | |
additional information | substrate specificity, overview. Homogalacturonan substrates are HG96B20, HG96B39 HG96B56, HG96B69, HG96B82, HG96P14, HG96P36, HG96P56, HG96P64, and HG96P75. Spectrometric quantification | Arabidopsis thaliana | ? | - |
? | |
additional information | substrate specificity, overview. Homogalacturonan substrates are HG96B20, HG96B39 HG96B56, HG96B69, HG96B82, HG96P14, HG96P36, HG96P56, HG96P64, and HG96P75. Spectrometric quantification | Botrytis cinerea | ? | - |
? | |
additional information | substrate specificity, overview. Homogalacturonan substrates are HG96B20, HG96B39 HG96B56, HG96B69, HG96B82, HG96P14, HG96P36, HG96P56, HG96P64, and HG96P75. Spectrometric quantification | Botrytis cinerea B05.10 | ? | - |
? | |
pectin + n H2O | - |
Citrus sinensis | n methanol + pectate | - |
? | |
pectin + n H2O | - |
Arabidopsis thaliana | n methanol + pectate | - |
? | |
pectin + n H2O | - |
Botrytis cinerea | n methanol + pectate | - |
? | |
pectin + n H2O | substrate is Citrus pectin with a degree of methyl esterification (DM) of 30%, 65% and 90%, best substrate for enzyme AtPME is pectin DM 90% at pH 7.5 | Arabidopsis thaliana | n methanol + pectate | - |
? | |
pectin + n H2O | substrate is Citrus pectin with a degree of methylesterification (DM) of 30%, 65% and 90%, best substrate for enzyme BcPME is pectin DM 90% at pH 6.0 | Botrytis cinerea | n methanol + pectate | - |
? | |
pectin + n H2O | substrate is Citrus pectin with a degree of methylesterification (DM) of 30%, 65% and 90%, best substrate for enzyme CsPME is pectin DM 90% at pH 7.5 | Citrus sinensis | n methanol + pectate | - |
? | |
pectin + n H2O | - |
Botrytis cinerea B05.10 | n methanol + pectate | - |
? | |
pectin + n H2O | substrate is Citrus pectin with a degree of methylesterification (DM) of 30%, 65% and 90%, best substrate for enzyme BcPME is pectin DM 90% at pH 6.0 | Botrytis cinerea B05.10 | n methanol + pectate | - |
? |
Subunits | Comment | Organism |
---|---|---|
? | x * 32000, SDS-PAGE | Citrus sinensis |
? | x * 40000, recombinant His-tagged enzyme, SDS-PAGE | Arabidopsis thaliana |
? | x * 37000, recombinant enzyme, SDS-PAGE | Botrytis cinerea |
Synonyms | Comment | Organism |
---|---|---|
BcPME1 | - |
Botrytis cinerea |
CsPME | - |
Citrus sinensis |
pectin methylesterase | - |
Citrus sinensis |
pectin methylesterase | - |
Arabidopsis thaliana |
pectin methylesterase | - |
Botrytis cinerea |
pectinesterase 31 | - |
Arabidopsis thaliana |
PME | - |
Citrus sinensis |
PME | - |
Arabidopsis thaliana |
PME | - |
Botrytis cinerea |
PME31 | - |
Arabidopsis thaliana |
Temperature Optimum [°C] | Temperature Optimum Maximum [°C] | Comment | Organism |
---|---|---|---|
30 | - |
assay at | Citrus sinensis |
30 | - |
assay at | Arabidopsis thaliana |
30 | - |
assay at | Botrytis cinerea |
Temperature Stability Minimum [°C] | Temperature Stability Maximum [°C] | Comment | Organism |
---|---|---|---|
85 | - |
purified enzyme, 10 min, inactivation | Citrus sinensis |
85 | - |
purified enzyme, 10 min, inactivation | Arabidopsis thaliana |
85 | - |
purified enzyme, 10 min, inactivation | Botrytis cinerea |
pH Optimum Minimum | pH Optimum Maximum | Comment | Organism |
---|---|---|---|
4 | 6 | compared to pH 7.5, homogalacturonans as substrates | Botrytis cinerea |
6 | 7.5 | compared to pH 4.0, homogalacturonans as substrates | Citrus sinensis |
6 | 7.5 | compared to pH 4.0, homogalacturonans as substrates | Arabidopsis thaliana |
6 | - |
compared to pH 4.0 and pH 7.5, Citrus pectins as substrates | Botrytis cinerea |
7.5 | - |
compared to pH 4.0 and pH 6.0, very low activity at pH 4.0, Citrus pectins as substrates | Arabidopsis thaliana |
7.5 | - |
compared to pH 6.0 and pH 4.0, low activity at pH 4.0, Citrus pectins as substrates | Citrus sinensis |
General Information | Comment | Organism |
---|---|---|
evolution | sequence comparisons of pectinesterase enzymes from Citrus sinensis, Arabidopsis thaliana, and Botrytis cinerea | Citrus sinensis |
evolution | sequence comparisons of pectinesterase enzymes from Citrus sinensis, Arabidopsis thaliana, and Botrytis cinerea | Arabidopsis thaliana |
evolution | sequence comparisons of pectinesterase enzymes from Citrus sinensis, Arabidopsis thaliana, and Botrytis cinerea | Botrytis cinerea |
physiological function | pectin methylesterases (PMEs) are present in phytopathogens such as bacteria and fungi | Botrytis cinerea |
physiological function | pectin methylesterases (PMEs) play a central role in pectin remodeling during plant development | Citrus sinensis |
physiological function | pectin methylesterases (PMEs) play a central role in pectin remodeling during plant development | Arabidopsis thaliana |